Difference between revisions of "RXN-13182"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLEIC_ACID LINOLEIC_ACID] == * smiles: ** CCCCCC=CCC=CCCCCCCCC([O-])=O * inchi key: ** InChI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN] == * direction: ** L...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** myo-inositol-1(or_4)-monophosphatase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.3.25 EC-3.1.3.25] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[1-L-MYO-INOSITOL-1-P]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[MYO-INOSITOL]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 1D-myo-inositol 3-monophosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 myo-inositol[c] |
− | * [[ | + | |
− | + | == Genes associated with this reaction == | |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_11614]] | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | * [[Tiso_gene_14713]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | * [[Tiso_gene_4855]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_10754]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_2527]] | ||
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***AUTOMATED-NAME-MATCH | ||
+ | ** EXPERIMENTAL_ANNOTATION | ||
+ | ***AUTOMATED-NAME-MATCH | ||
+ | * [[Tiso_gene_15599]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | * [[Tiso_gene_12601]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-2301]], myo-inositol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2301 PWY-2301] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30742 30742] |
− | * | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01187 R01187] | |
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P20456 P20456] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P0ADG4 P0ADG4] |
− | * | + | ** [http://www.uniprot.org/uniprot/P29218 P29218] |
− | * | + | ** [http://www.uniprot.org/uniprot/P54928 P54928] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P54927 P54927] |
− | * | + | ** [http://www.uniprot.org/uniprot/O49071 O49071] |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: common name=myo-inositol-1(or_4)-monophosphatase}} | |
− | ** [http://www. | + | {{#set: ec number=EC-3.1.3.25}} |
− | + | {{#set: gene associated=Tiso_gene_11614|Tiso_gene_14713|Tiso_gene_4855|Tiso_gene_10754|Tiso_gene_2527|Tiso_gene_15599|Tiso_gene_12601}} | |
− | {{#set: | + | {{#set: in pathway=PWY-2301}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|orthology-creinhardtii}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:32, 18 March 2018
Contents
Reaction MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- myo-inositol-1(or_4)-monophosphatase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 1-L-MYO-INOSITOL-1-P[c] + 1 WATER[c] => 1 Pi[c] + 1 MYO-INOSITOL[c]
- With common name(s):
- 1 1D-myo-inositol 3-monophosphate[c] + 1 H2O[c] => 1 phosphate[c] + 1 myo-inositol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_11614
- Tiso_gene_14713
- Tiso_gene_4855
- Tiso_gene_10754
- Tiso_gene_2527
- IN-SILICO_ANNOTATION
- AUTOMATED-NAME-MATCH
- EXPERIMENTAL_ANNOTATION
- AUTOMATED-NAME-MATCH
- IN-SILICO_ANNOTATION
- Tiso_gene_15599
- Tiso_gene_12601
Pathways
- PWY-2301, myo-inositol biosynthesis: PWY-2301
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links