Difference between revisions of "Tiso gene 1602"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...") |
(Created page with "Category:Gene == Gene Tiso_gene_4288 == * left end position: ** 77 * transcription direction: ** POSITIVE * right end position: ** 3158 * centisome position: ** 0.5107455...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4288 == |
− | * | + | * left end position: |
− | ** | + | ** 77 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3158 |
− | * | + | * centisome position: |
− | ** | + | ** 0.5107455 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * [[HYDROG-RXN]] | |
− | == | + | ** in-silico_annotation |
− | * [[ | + | ***ec-number |
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6780]] | ||
+ | * [[GLUDEG-II-PWY]] | ||
+ | * [[PWY-6785]] | ||
+ | * [[PWY-6759]] | ||
+ | * [[PWY4LZ-257]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=77}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3158}} | |
− | + | {{#set: centisome position=0.5107455 }} | |
− | + | {{#set: reaction associated=HYDROG-RXN}} | |
− | + | {{#set: pathway associated=PWY-6780|GLUDEG-II-PWY|PWY-6785|PWY-6759|PWY4LZ-257}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:32, 18 March 2018
Gene Tiso_gene_4288
- left end position:
- 77
- transcription direction:
- POSITIVE
- right end position:
- 3158
- centisome position:
- 0.5107455
- Synonym(s):
Reactions associated
- HYDROG-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation