Difference between revisions of "Tiso gene 7329"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Nonmethylated-Ribosomal-Protein-L11s Nonmethylated-Ribosomal-Protein-L11s] == * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-SELENOCYSTEINE L-SELENOCYSTEINE] == * smiles: ** C([Se])C([N+])C([O-])=O * inchi key: ** InCh...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-SELENOCYSTEINE L-SELENOCYSTEINE] == |
+ | * smiles: | ||
+ | ** C([Se])C([N+])C([O-])=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** L-selenocysteine |
+ | * molecular weight: | ||
+ | ** 168.054 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** U | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12728]] |
+ | * [[SUCHMSSELCYSLh]] | ||
+ | * [[ACHMSSELCYSL]] | ||
+ | * [[ACHMSSELCYSLh]] | ||
+ | * [[SUCHMSSELCYSL]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12726]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: consumed by= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05688 C05688] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57843 57843] | ||
+ | * METABOLIGHTS : MTBLC57843 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245418 25245418] | ||
+ | * HMDB : HMDB03288 | ||
+ | {{#set: smiles=C([Se])C([N+])C([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N}} | ||
+ | {{#set: common name=L-selenocysteine}} | ||
+ | {{#set: molecular weight=168.054 }} | ||
+ | {{#set: common name=U}} | ||
+ | {{#set: consumed by=RXN-12728|SUCHMSSELCYSLh|ACHMSSELCYSL|ACHMSSELCYSLh|SUCHMSSELCYSL}} | ||
+ | {{#set: produced by=RXN-12726}} |
Revision as of 19:32, 18 March 2018
Contents
Metabolite L-SELENOCYSTEINE
- smiles:
- C([Se])C([N+])C([O-])=O
- inchi key:
- InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N
- common name:
- L-selenocysteine
- molecular weight:
- 168.054
- Synonym(s):
- U
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([Se])C([N+])C([O-])=O" cannot be used as a page name in this wiki.