Difference between revisions of "Tiso gene 7378"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * inchi key: ** InChIKey=PCKPVGOLPK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPATE TROPATE] == * smiles: ** C(O)C(C1(C=CC=CC=1))C([O-])=O * inchi key: ** InChIKey=JACRWUW...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPATE TROPATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(O)C(C1(C=CC=CC=1))C([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=JACRWUWPXAESPB-UHFFFAOYSA-M |
* common name: | * common name: | ||
| − | ** | + | ** tropate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 165.168 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[TROPINESTERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| + | * NCI: | ||
| + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=20990 20990] | ||
| + | * CAS : 529-64-6 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460086 5460086] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01456 C01456] | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.4573754.html 4573754] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17000 17000] |
| − | + | {{#set: smiles=C(O)C(C1(C=CC=CC=1))C([O-])=O}} | |
| − | + | {{#set: inchi key=InChIKey=JACRWUWPXAESPB-UHFFFAOYSA-M}} | |
| − | + | {{#set: common name=tropate}} | |
| − | {{#set: smiles= | + | {{#set: molecular weight=165.168 }} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: produced by=TROPINESTERASE-RXN}} |
| − | {{#set: common name= | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 18:34, 18 March 2018
Contents
Metabolite TROPATE
- smiles:
- C(O)C(C1(C=CC=CC=1))C([O-])=O
- inchi key:
- InChIKey=JACRWUWPXAESPB-UHFFFAOYSA-M
- common name:
- tropate
- molecular weight:
- 165.168
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(C1(C=CC=CC=1))C([O-])=O" cannot be used as a page name in this wiki.
