Difference between revisions of "3.6.4.6-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11501 RXN-11501] == * direction: ** LEFT-TO-RIGHT * common name: ** alpha-galactosidase * ec nu...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] == * smiles: ** C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O * inchi key: ** InChIKey=I...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11501 RXN-11501] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O
 +
* inchi key:
 +
** InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L
 
* common name:
 
* common name:
−
** alpha-galactosidase
+
** α-D-xylose 1-phosphate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.2.1.22 EC-3.2.1.22]
+
** 228.095   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[WATER]][c] '''+''' 1 [[CPD-170]][c] '''=>''' 1 [[ALPHA-D-GALACTOSE]][c] '''+''' 1 [[CPD-1099]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[2.7.7.11-RXN]]
−
** 1 H2O[c] '''+''' 1 stachyose[c] '''=>''' 1 α-D-galactose[c] '''+''' 1 raffinose[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_16101]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_4615]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_8673]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_3392]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
** [[pantograph]]-[[athaliana]]
+
−
== Pathways  ==
+
−
* [[PWY-6527]], stachyose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6527 PWY-6527]
+
−
** '''7''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
−
*** [[esiliculosus]]
+
−
*** [[athaliana]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R03634 R03634]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202995 25202995]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=alpha-galactosidase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57559 57559]
−
{{#set: ec number=EC-3.2.1.22}}
+
* LIGAND-CPD:
−
{{#set: gene associated=Tiso_gene_16101|Tiso_gene_4615|Tiso_gene_8673|Tiso_gene_3392}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03737 C03737]
−
{{#set: in pathway=PWY-6527}}
+
{{#set: smiles=C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=α-D-xylose 1-phosphate}}
−
{{#set: reconstruction source=creinhardtii|esiliculosus|athaliana}}
+
{{#set: molecular weight=228.095    }}
−
{{#set: reconstruction category=annotation}}
+
{{#set: reversible reaction associated=2.7.7.11-RXN}}
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Revision as of 19:35, 18 March 2018

Metabolite CPD-490

  • smiles:
    • C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O
  • inchi key:
    • InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L
  • common name:
    • α-D-xylose 1-phosphate
  • molecular weight:
    • 228.095
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3.6.4.6-RXN&oldid=25435"