Difference between revisions of "Tiso gene 11659"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13297 RXN-13297] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13297 RXN-13297] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=LOJUQFSPYHMHEO-SGHXUWJISA-N
+
** [http://enzyme.expasy.org/EC/2.3.1.199 EC-2.3.1.199]
−
* common name:
+
−
** ubiquinol-8
+
−
* molecular weight:
+
−
** 729.137   
+
 
* Synonym(s):
 
* Synonym(s):
−
** ubiquinol(8)
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[DHHB-METHYLTRANSFER-RXN]]
+
** 1 [[MALONYL-COA]][c] '''+''' 1 [[CPD-10279]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-14273]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
* [[NADHor_2m]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 malonyl-CoA[c] '''+''' 1 docosanoyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 3-oxo-lignoceroyl-CoA[c] '''+''' 1 coenzyme A[c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036]
 +
** '''16''' reactions found over '''16''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25074411 25074411]
+
{{#set: ec number=EC-2.3.1.199}}
−
* CHEBI:
+
{{#set: in pathway=PWY-7036}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61682 61682]
+
{{#set: reconstruction category=annotation}}
−
* BIGG : q8h2
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
* HMDB : HMDB01060
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)}}
+
−
{{#set: inchi key=InChIKey=LOJUQFSPYHMHEO-SGHXUWJISA-N}}
+
−
{{#set: common name=ubiquinol-8}}
+
−
{{#set: molecular weight=729.137    }}
+
−
{{#set: common name=ubiquinol(8)}}
+
−
{{#set: produced by=DHHB-METHYLTRANSFER-RXN|NADHor_2m}}
+

Revision as of 18:35, 18 March 2018

Reaction RXN-13297

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7036, very long chain fatty acid biosynthesis II: PWY-7036
    • 16 reactions found over 16 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11659&oldid=25471"