Difference between revisions of "Tiso gene 6675"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] == * smiles: ** C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O * inchi key: ** InChIKey=I...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-cis-D9-hexadecenoyl-ACPs 3-oxo-cis-D9-hexadecenoyl-ACPs] == * common name: ** a 3-oxo-cis...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-cis-D9-hexadecenoyl-ACPs 3-oxo-cis-D9-hexadecenoyl-ACPs] ==
* smiles:
+
** C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O
+
* inchi key:
+
** InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L
+
 
* common name:
 
* common name:
** α-D-xylose 1-phosphate
+
** a 3-oxo-cis-Δ9-hexadecenoyl-[acp]
* molecular weight:
+
** 228.095   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a 3-oxo-cis-&DElta;9-hexadecenoyl-[acyl-carrier-protein]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10659]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10658]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[2.7.7.11-RXN]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 3-oxo-cis-Δ9-hexadecenoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202995 25202995]
+
{{#set: common name=a 3-oxo-cis-&DElta;9-hexadecenoyl-[acyl-carrier-protein]}}
* CHEBI:
+
{{#set: consumed by=RXN-10659}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57559 57559]
+
{{#set: produced by=RXN-10658}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03737 C03737]
+
{{#set: smiles=C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O}}
+
{{#set: inchi key=InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L}}
+
{{#set: common name=α-D-xylose 1-phosphate}}
+
{{#set: molecular weight=228.095    }}
+
{{#set: consumed or produced by=2.7.7.11-RXN}}
+

Revision as of 18:35, 18 March 2018

Metabolite 3-oxo-cis-D9-hexadecenoyl-ACPs

  • common name:
    • a 3-oxo-cis-Δ9-hexadecenoyl-[acp]
  • Synonym(s):
    • a 3-oxo-cis-&DElta;9-hexadecenoyl-[acyl-carrier-protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 3-oxo-cis-Δ9-hexadecenoyl-[acp" cannot be used as a page name in this wiki.
"a 3-oxo-cis-&DElta;9-hexadecenoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.