Difference between revisions of "RXN-10059"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=S-FORMYLGLUTATHIONE-HYDROLASE-RXN S-FORMYLGLUTATHIONE-HYDROLASE-RXN] == * direction: ** LEFT-TO-RIG...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] == * smiles: ** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1) * inc...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1) |
| + | * inchi key: | ||
| + | ** InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al |
| − | * | + | * molecular weight: |
| − | ** | + | ** 382.542 |
* Synonym(s): | * Synonym(s): | ||
| + | ** C25-allenic-apo-aldehyde | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-698]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http://www.ebi.ac.uk/ | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245424 25245424] |
| − | * LIGAND- | + | * CHEBI: |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34596 34596] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C14044 C14044] |
| − | {{#set: | + | {{#set: smiles=CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N}} |
| − | {{#set: | + | {{#set: common name=(3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al}} |
| − | {{#set: | + | {{#set: molecular weight=382.542 }} |
| − | + | {{#set: common name=C25-allenic-apo-aldehyde}} | |
| − | + | {{#set: produced by=RXN-698}} | |
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 19:35, 18 March 2018
Contents
Metabolite CPD1F-4
- smiles:
- CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)
- inchi key:
- InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N
- common name:
- (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
- molecular weight:
- 382.542
- Synonym(s):
- C25-allenic-apo-aldehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
