Difference between revisions of "L-methionyl-L-seryl-Protein"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] == * smiles: ** C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_9051 == * left end position: ** 913 * transcription direction: ** POSITIVE * right end position: ** 3946 * centisome position: ** 9.449390...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_9051 == |
− | * | + | * left end position: |
− | ** | + | ** 913 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3946 |
− | * | + | * centisome position: |
− | ** | + | ** 9.449390 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]] | |
− | == | + | ** in-silico_annotation |
− | * [[ | + | ***ec-number |
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[UDPNACETYLGALSYN-PWY]] | ||
+ | * [[PWY-6749]] | ||
+ | * [[UDPNAGSYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=913}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: right end position=3946}} |
− | {{#set: | + | {{#set: centisome position=9.449390 }} |
− | {{#set: | + | {{#set: reaction associated=L-GLN-FRUCT-6-P-AMINOTRANS-RXN}} |
− | {{#set: | + | {{#set: pathway associated=UDPNACETYLGALSYN-PWY|PWY-6749|UDPNAGSYN-PWY}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:36, 18 March 2018
Gene Tiso_gene_9051
- left end position:
- 913
- transcription direction:
- POSITIVE
- right end position:
- 3946
- centisome position:
- 9.449390
- Synonym(s):
Reactions associated
- L-GLN-FRUCT-6-P-AMINOTRANS-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- pantograph-creinhardtii
- in-silico_annotation