Difference between revisions of "CPD1G-1346"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13533 CPD-13533] == * smiles: ** CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12443 CPD-12443] == * common name: ** perillate * Synonym(s): ** perillic acid ** perillyl...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13533 CPD-13533] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12443 CPD-12443] ==
* smiles:
+
** CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O)O
+
* inchi key:
+
** InChIKey=YYGYPCRWZMLSGK-ORUMCERNSA-J
+
 
* common name:
 
* common name:
** (R)-3-hydroxyvaleryl-CoA
+
** perillate
* molecular weight:
+
** 863.619   
+
 
* Synonym(s):
 
* Synonym(s):
** D-β-hydroxyvaleryl-CoA
+
** perillic acid
 +
** perillyl carboxylate
 +
** 4-(1-methylethenyl)-1-cyclohexene-1-carboxylic acid
 +
** 4-isopropenylcyclohex-1-enecarboxylic acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-12560]]
+
* [[RXN-14280]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=perillate}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54758578 54758578]
+
{{#set: common name=perillic acid|perillyl carboxylate|4-(1-methylethenyl)-1-cyclohexene-1-carboxylic acid|4-isopropenylcyclohex-1-enecarboxylic acid}}
{{#set: smiles=CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O)O}}
+
{{#set: reversible reaction associated=RXN-14280}}
{{#set: inchi key=InChIKey=YYGYPCRWZMLSGK-ORUMCERNSA-J}}
+
{{#set: common name=(R)-3-hydroxyvaleryl-CoA}}
+
{{#set: molecular weight=863.619    }}
+
{{#set: common name=D-β-hydroxyvaleryl-CoA}}
+
{{#set: consumed or produced by=RXN-12560}}
+

Revision as of 18:36, 18 March 2018

Metabolite CPD-12443

  • common name:
    • perillate
  • Synonym(s):
    • perillic acid
    • perillyl carboxylate
    • 4-(1-methylethenyl)-1-cyclohexene-1-carboxylic acid
    • 4-isopropenylcyclohex-1-enecarboxylic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links