Difference between revisions of "CPD-10806"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_9428 == * Synonym(s): == Reactions associated == * RXN-1224 ** pantograph-esiliculosus * RXN-15117 ** pantograph-ath...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17422 CPD-17422] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_9428 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17422 CPD-17422] ==
 +
* smiles:
 +
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N
 +
* common name:
 +
** 3-dehydro-6-hydroxyteasterone
 +
* molecular weight:
 +
** 448.685   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-1224]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-11535]]
* [[RXN-15117]]
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[athaliana]]
+
== Pathways associated ==
+
* [[PWY-7817]]
+
* [[PWYQT-4427]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-1224|RXN-15117}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-7817|PWYQT-4427}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515138 102515138]
 +
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N}}
 +
{{#set: common name=3-dehydro-6-hydroxyteasterone}}
 +
{{#set: molecular weight=448.685    }}
 +
{{#set: produced by=RXN-11535}}

Revision as of 18:38, 18 March 2018

Metabolite CPD-17422

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N
  • common name:
    • 3-dehydro-6-hydroxyteasterone
  • molecular weight:
    • 448.685
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.