Difference between revisions of "GALACTOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-phenylalanyl-L-arginyl-Protein L-phenylalanyl-L-arginyl-Protein] == * common name: ** L-pheny...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-phenylalanyl-L-arginyl-Protein L-phenylalanyl-L-arginyl-Protein] ==
* smiles:
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
+
* inchi key:
+
** InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
+
 
* common name:
 
* common name:
** 5α-cholesta-8-en-3-one
+
** L-phenylalanyl-L-arginyl-[protein]
* molecular weight:
+
** 384.644   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-23]]
+
* [[RXN-17847]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=L-phenylalanyl-L-arginyl-[protein]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263324 44263324]
+
{{#set: produced by=RXN-17847}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87056 87056]
+
* HMDB : HMDB12178
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C}}
+
{{#set: inchi key=InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N}}
+
{{#set: common name=5α-cholesta-8-en-3-one}}
+
{{#set: molecular weight=384.644    }}
+
{{#set: produced by=RXN66-23}}
+

Revision as of 18:38, 18 March 2018

Metabolite L-phenylalanyl-L-arginyl-Protein

  • common name:
    • L-phenylalanyl-L-arginyl-[protein]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"L-phenylalanyl-L-arginyl-[protein" cannot be used as a page name in this wiki.