Difference between revisions of "PPPGO"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] == * smiles: ** CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10851 RXN-10851] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10851 RXN-10851] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[Donor-H2]][c] '''+''' 2 [[CPD-11281]][c] '''<=>''' 1 [[HS]][c] '''+''' 1 [[CPD-11763]][c] '''+''' 1 [[Acceptor]][c] | |
− | + | * With common name(s): | |
− | * [ | + | ** 1 a reduced electron acceptor[c] '''+''' 2 S-sulfanylglutathione[c] '''<=>''' 1 hydrogen sulfide[c] '''+''' 1 bisorganyltrisulfane[c] '''+''' 1 an oxidized electron acceptor[c] |
− | == | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | == Pathways == |
− | * [[ | + | * [[PWY-5294]], superpathway of sulfide oxidation (Acidithiobacillus ferrooxidans): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5294 PWY-5294] |
− | + | ** '''2''' reactions found over '''12''' reactions in the full pathway | |
− | * [[ | + | == Reconstruction information == |
− | * [[ | + | * Category: [[annotation]] |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: in pathway=PWY-5294}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 19:38, 18 March 2018
Contents
Reaction RXN-10851
- direction:
- REVERSIBLE
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 a reduced electron acceptor[c] + 2 S-sulfanylglutathione[c] <=> 1 hydrogen sulfide[c] + 1 bisorganyltrisulfane[c] + 1 an oxidized electron acceptor[c]
Genes associated with this reaction
Pathways
- PWY-5294, superpathway of sulfide oxidation (Acidithiobacillus ferrooxidans): PWY-5294
- 2 reactions found over 12 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation