Difference between revisions of "GLYNA1tm"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4484 == * left end position: ** 452 * transcription direction: ** NEGATIVE * right end position: ** 5028 * centisome position: ** 3.0552928...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == * smiles: ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N |
| − | * | + | * common name: |
| − | ** | + | ** cotinine |
| − | * | + | * molecular weight: |
| − | ** | + | ** 176.218 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN66-169]] |
| − | * | + | * [[RXN66-161]] |
| − | * | + | * [[RXN66-168]] |
| − | * [[ | + | * [[RXN66-163]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=854019 854019] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.746405.html 746405] |
| − | {{#set: | + | * CHEBI: |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68641 68641] | |
| + | * METABOLIGHTS : MTBLC68641 | ||
| + | * HMDB : HMDB01046 | ||
| + | {{#set: smiles=C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))}} | ||
| + | {{#set: inchi key=InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N}} | ||
| + | {{#set: common name=cotinine}} | ||
| + | {{#set: molecular weight=176.218 }} | ||
| + | {{#set: consumed by=RXN66-169|RXN66-161|RXN66-168|RXN66-163}} | ||
Revision as of 19:39, 18 March 2018
Contents
Metabolite CPD-2742
- smiles:
- C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))
- inchi key:
- InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N
- common name:
- cotinine
- molecular weight:
- 176.218
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))" cannot be used as a page name in this wiki.
