Difference between revisions of "1.11.1.12-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] == * smiles: ** CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-] * inchi key: ** InChIKey=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-160 RXN1F-160] == * direction: ** LEFT-TO-RIGHT * common name: ** ent-7α-hydroxykaur-16...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-160 RXN1F-160] ==
−
* smiles:
+
* direction:
−
** CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OKZYCXHTTZZYSK-ZCFIWIBFSA-K
+
 
* common name:
 
* common name:
−
** (R)-mevalonate 5-phosphate
+
** ent-7α-hydroxykaur-16-en-19-oate monooxygenase
−
* molecular weight:
+
−
** 225.115   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (R)-5-phosphomevalonic acid
 
−
** mevalonate-5P
 
−
** (R)-5-phosphomevalonate
 
−
** (R)-mevalonic acid 5-phosphate
 
−
** mevalonate-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD1F-136]][c] '''=>''' 1 [[CPD1F-138]][c] '''+''' 2 [[WATER]][c] '''+''' 1 [[NADP]][c]
−
* [[MEVALONATE-KINASE-RXN]]
+
* With common name(s):
 +
** 1 NADPH[c] '''+''' 1 oxygen[c] '''+''' 1 H+[c] '''+''' 1 ent-7α-hydroxykaur-16-en-19-oate[c] '''=>''' 1 gibberellin A12-aldehyde[c] '''+''' 2 H2O[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_3577]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_8263]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5047]], gibberellin biosynthesis IV (Gibberella fujikuroi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5047 PWY-5047]
 +
** '''6''' reactions found over '''15''' reactions in the full pathway
 +
* [[PWY-5034]], GA12 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5034 PWY-5034]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 73566-35-5
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22904 22904]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244548 25244548]
+
* LIGAND-RXN:
−
* HMDB : HMDB01343
+
** [http://www.genome.jp/dbget-bin/www_bget?R06295 R06295]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01107 C01107]
+
{{#set: common name=ent-7α-hydroxykaur-16-en-19-oate monooxygenase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_3577|Tiso_gene_8263}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58146 58146]
+
{{#set: in pathway=PWY-5047|PWY-5034}}
−
* METABOLIGHTS : MTBLC58146
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-]}}
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
{{#set: inchi key=InChIKey=OKZYCXHTTZZYSK-ZCFIWIBFSA-K}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=(R)-mevalonate 5-phosphate}}
+
−
{{#set: molecular weight=225.115    }}
+
−
{{#set: common name=(R)-5-phosphomevalonic acid|mevalonate-5P|(R)-5-phosphomevalonate|(R)-mevalonic acid 5-phosphate|mevalonate-P}}
+
−
{{#set: consumed or produced by=MEVALONATE-KINASE-RXN}}
+

Revision as of 18:39, 18 March 2018

Reaction RXN1F-160

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ent-7α-hydroxykaur-16-en-19-oate monooxygenase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NADPH[c] + 1 oxygen[c] + 1 H+[c] + 1 ent-7α-hydroxykaur-16-en-19-oate[c] => 1 gibberellin A12-aldehyde[c] + 2 H2O[c] + 1 NADP+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5047, gibberellin biosynthesis IV (Gibberella fujikuroi): PWY-5047
    • 6 reactions found over 15 reactions in the full pathway
  • PWY-5034, GA12 biosynthesis: PWY-5034
    • 6 reactions found over 6 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=1.11.1.12-RXN&oldid=25969"