Difference between revisions of "UTPPH"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-2-HYDROXY-BUTYRATE 2-ACETO-2-HYDROXY-BUTYRATE] == * smiles: ** CCC(O)(C(=O)[O-])C(C)=O...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1325 RXN1G-1325] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis,cis-delt...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1325 RXN1G-1325] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** trans-delta2-cis,cis-delta15,33-C52:3-[acyl-carrier protein] reductase (NADPH, B-specific) |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.3.1.M4 EC-1.3.1.M4] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[PROTON]][c] '''+''' 1 [[trans-D2-cis-cis-D15-33-C52-3-ACPs]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[cis-cis-D15-33-C52-2-ACPs]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 H+[c] '''+''' 1 a trans-delta2-cis,cis-delta15,33-C52:3-[acp][c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 a cis,cis-delta15,33-C52:2-[acp][c] |
| − | * [[ | + | |
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_10778]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | ||
| + | ** '''86''' reactions found over '''182''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=trans-delta2-cis,cis-delta15,33-C52:3-[acyl-carrier protein] reductase (NADPH, B-specific)}} | |
| − | + | {{#set: ec number=EC-1.3.1.M4}} | |
| − | + | {{#set: gene associated=Tiso_gene_10778}} | |
| − | + | {{#set: in pathway=PWYG-321}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 19:39, 18 March 2018
Contents
Reaction RXN1G-1325
- direction:
- LEFT-TO-RIGHT
- common name:
- trans-delta2-cis,cis-delta15,33-C52:3-[acyl-carrier protein] reductase (NADPH, B-specific)
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 trans-D2-cis-cis-D15-33-C52-3-ACPs[c] + 1 NADH[c] => 1 NAD[c] + 1 cis-cis-D15-33-C52-2-ACPs[c]
- With common name(s):
- 1 H+[c] + 1 a trans-delta2-cis,cis-delta15,33-C52:3-[acp][c] + 1 NADH[c] => 1 NAD+[c] + 1 a cis,cis-delta15,33-C52:2-[acp][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
"trans-delta2-cis,cis-delta15,33-C52:3-[acyl-carrier protein] reductase (NADPH, B-specific)" cannot be used as a page name in this wiki.
