Difference between revisions of "CPD-15688"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9868 RXN-9868] == * direction: ** LEFT-TO-RIGHT * common name: ** carboxymethylenebutenolidase...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9868 RXN-9868] ==
* smiles:
+
* direction:
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N
+
 
* common name:
 
* common name:
** episterol
+
** carboxymethylenebutenolidase
* molecular weight:
+
* ec number:
** 398.671   
+
** [http://enzyme.expasy.org/EC/3.1.1.45 EC-3.1.1.45]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN3O-218]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-10608]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-294]][c] '''+''' 1 [[PROTON]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 trans-dienelactone[c] '''+''' 1 H2O[c] '''=>''' 1 2-maleylacetate[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_12835]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6089]], 3-chlorocatechol degradation I (ortho): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6089 PWY-6089]
 +
** '''1''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724571 23724571]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06838 R06838]
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50586 50586]
+
{{#set: common name=carboxymethylenebutenolidase}}
* LIGAND-CPD:
+
{{#set: ec number=EC-3.1.1.45}}
** [http://www.genome.jp/dbget-bin/www_bget?C15777 C15777]
+
{{#set: gene associated=Tiso_gene_12835}}
* HMDB : HMDB06847
+
{{#set: in pathway=PWY-6089}}
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))}}
+
{{#set: reconstruction category=annotation}}
{{#set: inchi key=InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: common name=episterol}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: molecular weight=398.671    }}
+
{{#set: consumed by=RXN3O-218}}
+

Revision as of 18:40, 18 March 2018

Reaction RXN-9868

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • carboxymethylenebutenolidase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 trans-dienelactone[c] + 1 H2O[c] => 1 2-maleylacetate[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6089, 3-chlorocatechol degradation I (ortho): PWY-6089
    • 1 reactions found over 5 reactions in the full pathway

Reconstruction information

External links