Difference between revisions of "RXN-7745"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * smiles: ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=B...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17881 RXN-17881] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17881 RXN-17881] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[N-terminal-L-cysteine]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[N-terminal-L-alanine-sulfenate]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 hydrogen peroxide[c] '''+''' 1 an N-terminal L-cysteinyl-[protein][c] '''=>''' 1 H2O[c] '''+''' 1 an N-terminal 3-sulfeno-L-alanyl-[protein][c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[PWY-7799]], Arg/N-end rule pathway (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7799 PWY-7799] | ||
| + | ** '''8''' reactions found over '''14''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: in pathway=PWY-7799}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 18:40, 18 March 2018
Contents
Reaction RXN-17881
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 HYDROGEN-PEROXIDE[c] + 1 N-terminal-L-cysteine[c] => 1 WATER[c] + 1 N-terminal-L-alanine-sulfenate[c]
- With common name(s):
- 1 hydrogen peroxide[c] + 1 an N-terminal L-cysteinyl-[protein][c] => 1 H2O[c] + 1 an N-terminal 3-sulfeno-L-alanyl-[protein][c]
Genes associated with this reaction
Pathways
- PWY-7799, Arg/N-end rule pathway (eukaryotic): PWY-7799
- 8 reactions found over 14 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
