Difference between revisions of "Tiso gene 15088"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13403 RXN-13403] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13403 RXN-13403] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J
+
** [http://enzyme.expasy.org/EC/2.1.1.107 EC-2.1.1.107]
−
* common name:
+
−
** 3-oxo-(5Z)-dodecenoyl-CoA
+
−
* molecular weight:
+
−
** 957.775   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-12:1-Δ5-CoA
 
−
** 3-oxo-5-cis-dodecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17799]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[UROPORPHYRINOGEN-III]][c] '''+''' 2 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[DIHYDROSIROHYDROCHLORIN]][c] '''+''' 2 [[ADENOSYL-HOMO-CYS]][c]
−
* [[RXN-17798]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 uroporphyrinogen-III[c] '''+''' 2 S-adenosyl-L-methionine[c] '''=>''' 1 H+[c] '''+''' 1 precorrin-2[c] '''+''' 2 S-adenosyl-L-homocysteine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_8614]]
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[synechocystis]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* RHEA:
−
{{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J}}
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32459 32459]
−
{{#set: common name=3-oxo-(5Z)-dodecenoyl-CoA}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: molecular weight=957.775    }}
+
{{#set: ec number=EC-2.1.1.107}}
−
{{#set: common name=3-oxo-12:1-Δ5-CoA|3-oxo-5-cis-dodecenoyl-CoA}}
+
{{#set: gene associated=Tiso_gene_8614}}
−
{{#set: consumed by=RXN-17799}}
+
{{#set: in pathway=}}
−
{{#set: produced by=RXN-17798}}
+
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-athaliana|orthology-creinhardtii|orthology-synechocystis|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Revision as of 19:41, 18 March 2018

Reaction RXN-13403

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15088&oldid=26116"