Difference between revisions of "RXN-15131"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+]...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-behenoyl-ACPs 3-oxo-behenoyl-ACPs] == * common name: ** a 3-oxo-behenoyl-[acp] * Synonym(...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-behenoyl-ACPs 3-oxo-behenoyl-ACPs] ==
* smiles:
+
** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O
+
* inchi key:
+
** InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N
+
 
* common name:
 
* common name:
** 1-18:1-2-18:1-phosphatidylethanolamine
+
** a 3-oxo-behenoyl-[acp]
* molecular weight:
+
** 744.043   
+
 
* Synonym(s):
 
* Synonym(s):
** phosphatidylethanolamine (1-18:1-2-18:1)
+
** a 3-oxo-behenoyl [acyl-carrier-protein]
** 18:1-18:1-PE
+
** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15067]]
+
* [[RXN1G-157]]
* [[PE1819Z1819Zt]]
+
* [[RXN1G-469]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PE1819Z1819Zt]]
+
* [[RXN1G-445]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-15036]]
+
* [[RXN1G-460]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 3-oxo-behenoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44251425 44251425]
+
{{#set: common name=a 3-oxo-behenoyl [acyl-carrier-protein]}}
* CHEBI:
+
{{#set: consumed by=RXN1G-157|RXN1G-469}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74986 74986]
+
{{#set: produced by=RXN1G-445}}
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O}}
+
{{#set: reversible reaction associated=RXN1G-460}}
{{#set: inchi key=InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N}}
+
{{#set: common name=1-18:1-2-18:1-phosphatidylethanolamine}}
+
{{#set: molecular weight=744.043    }}
+
{{#set: common name=phosphatidylethanolamine (1-18:1-2-18:1)|18:1-18:1-PE|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}}
+
{{#set: consumed by=RXN-15067|PE1819Z1819Zt}}
+
{{#set: produced by=PE1819Z1819Zt}}
+
{{#set: consumed or produced by=RXN-15036}}
+

Revision as of 19:41, 18 March 2018

Metabolite 3-oxo-behenoyl-ACPs

  • common name:
    • a 3-oxo-behenoyl-[acp]
  • Synonym(s):
    • a 3-oxo-behenoyl [acyl-carrier-protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 3-oxo-behenoyl-[acp" cannot be used as a page name in this wiki.
"a 3-oxo-behenoyl [acyl-carrier-protein" cannot be used as a page name in this wiki.