Difference between revisions of "ATID"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == * smiles: ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Tiso_gene_16719 == * left end position: ** 72 * transcription direction: ** NEGATIVE * right end position: ** 3225 * centisome position: ** 1.7282765...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_16719 == |
− | * | + | * left end position: |
− | ** | + | ** 72 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3225 |
− | * | + | * centisome position: |
− | ** | + | ** 1.7282765 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[1.2.1.31-RXN]] | |
− | * [[ | + | ** in-silico_annotation |
− | == | + | ***ec-number |
+ | * [[ALLYSINE-DEHYDROG-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[ASPARTATE-RACEMASE-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-10855]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY66-425]] | ||
+ | * [[LYSINE-DEG1-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=72}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3225}} | |
− | + | {{#set: centisome position=1.7282765 }} | |
− | + | {{#set: reaction associated=1.2.1.31-RXN|ALLYSINE-DEHYDROG-RXN|ASPARTATE-RACEMASE-RXN|RXN-10855}} | |
− | {{#set: | + | {{#set: pathway associated=PWY66-425|LYSINE-DEG1-PWY}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:41, 18 March 2018
Gene Tiso_gene_16719
- left end position:
- 72
- transcription direction:
- NEGATIVE
- right end position:
- 3225
- centisome position:
- 1.7282765
- Synonym(s):
Reactions associated
- 1.2.1.31-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- ALLYSINE-DEHYDROG-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- ASPARTATE-RACEMASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-10855
- in-silico_annotation
- ec-number
- in-silico_annotation