Difference between revisions of "Tiso gene 18559"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * inchi key: ** InChIKey=WEZ...")
(Created page with "Category:Gene == Gene Tiso_gene_2100 == * Synonym(s): == Reactions associated == * 3.1.3.46-RXN ** experimental_annotation ***automated-name-match ** pantograph-[...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] ==
+
== Gene Tiso_gene_2100 ==
* smiles:
+
** C(=O)(C1(O)(C=CCCC(=O)1))[O-]
+
* inchi key:
+
** InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M
+
* common name:
+
** 6-hydroxy-2-cyclohexen-one-carboxylate
+
* molecular weight:
+
** 155.13   
+
 
* Synonym(s):
 
* Synonym(s):
** 6-hydroxy-2-cyclohexen-one-carboxylic acid
 
** HCC
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[3.1.3.46-RXN]]
* [[RXN-12252]]
+
** experimental_annotation
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
** [[pantograph]]-[[athaliana]]
 +
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 +
** experimental_annotation
 +
***ec-number
 +
** [[pantograph]]-[[athaliana]]
 +
== Pathways associated ==
 +
* [[PWY66-423]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=3.1.3.46-RXN|6-PHOSPHOFRUCTO-2-KINASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940166 52940166]
+
{{#set: pathway associated=PWY66-423}}
{{#set: smiles=C(=O)(C1(O)(C=CCCC(=O)1))[O-]}}
+
{{#set: inchi key=InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M}}
+
{{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylate}}
+
{{#set: molecular weight=155.13    }}
+
{{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylic acid|HCC}}
+
{{#set: produced by=RXN-12252}}
+

Revision as of 18:41, 18 March 2018

Gene Tiso_gene_2100

  • Synonym(s):

Reactions associated

Pathways associated

External links