Difference between revisions of "Tiso gene 15176"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] == * smiles: ** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R95 R95] == * direction: ** LEFT-TO-RIGHT * common name: ** R95 * Synonym(s): == Reaction Formula...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R95 R95] ==
−
* smiles:
+
* direction:
−
** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N
+
 
* common name:
 
* common name:
−
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
+
** R95
−
* molecular weight:
+
−
** 298.374   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP
 
−
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione
 
−
** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine
 
−
** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP
 
−
** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-15684]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[PROTON]][c] '''+''' 1.0 [[CPD1F-98]][c] '''+''' 1.0 [[OXYGEN-MOLECULE]][c] '''+''' 1.0 [[NADPH]][c] '''=>''' 1.0 [[NEUROSPORENE]][c] '''+''' 2.0 [[WATER]][c] '''+''' 1.0 [[NADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 H+[c] '''+''' 1.0 all-trans-ζ-carotene[c] '''+''' 1.0 oxygen[c] '''+''' 1.0 NADPH[c] '''=>''' 1.0 all-trans neurosporene[c] '''+''' 2.0 H2O[c] '''+''' 1.0 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_15802]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[Tiso_gene_917]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[Tiso_gene_13369]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[Tiso_gene_3092]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[Tiso_gene_7142]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[Tiso_gene_16795]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[Tiso_gene_16794]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[Tiso_gene_916]]
 +
** [[pantograph]]-[[synechocystis]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658023 90658023]
+
{{#set: common name=R95}}
−
{{#set: smiles=C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)}}
+
{{#set: gene associated=Tiso_gene_15802|Tiso_gene_917|Tiso_gene_13369|Tiso_gene_3092|Tiso_gene_7142|Tiso_gene_16795|Tiso_gene_16794|Tiso_gene_916}}
−
{{#set: inchi key=InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N}}
+
{{#set: in pathway=}}
−
{{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=298.374    }}
+
{{#set: reconstruction source=orthology-synechocystis}}
−
{{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: consumed by=RXN-15684}}
+

Revision as of 18:42, 18 March 2018

Reaction R95

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • R95
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H+[c] + 1.0 all-trans-ζ-carotene[c] + 1.0 oxygen[c] + 1.0 NADPH[c] => 1.0 all-trans neurosporene[c] + 2.0 H2O[c] + 1.0 NADP+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15176&oldid=26219"