Difference between revisions of "Tiso gene 9986"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == * smiles: ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) * inchi key: *...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14728 RXN-14728] == * direction: ** REVERSIBLE * common name: ** amidase * ec number: ** [http:...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14728 RXN-14728] ==
−
* smiles:
+
* direction:
−
** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K
+
 
* common name:
 
* common name:
−
** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
+
** amidase
−
* molecular weight:
+
* ec number:
−
** 264.169   
+
** [http://enzyme.expasy.org/EC/3.5.1.4 EC-3.5.1.4]
 
* Synonym(s):
 
* Synonym(s):
−
** cThz-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12610]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[ACETAMIDE]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[ACET]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 acetamide[c] '''+''' 1 H2O[c] '''<=>''' 1 ammonium[c] '''+''' 1 acetate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_13682]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53477624 53477624]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00321 R00321]
−
* CHEBI:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62890 62890]
+
{{#set: common name=amidase}}
−
{{#set: smiles=CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)}}
+
{{#set: ec number=EC-3.5.1.4}}
−
{{#set: inchi key=InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K}}
+
{{#set: gene associated=Tiso_gene_13682}}
−
{{#set: common name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate}}
+
{{#set: in pathway=}}
−
{{#set: molecular weight=264.169    }}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=cThz-P}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: consumed by=RXN-12610}}
+
{{#set: reconstruction tool=pathwaytools}}

Revision as of 18:43, 18 March 2018

Reaction RXN-14728

  • direction:
    • REVERSIBLE
  • common name:
    • amidase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 acetamide[c] + 1 H2O[c] <=> 1 ammonium[c] + 1 acetate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9986&oldid=26419"