Difference between revisions of "BETAGALACTOSID-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19150 CPD-19150] == * smiles: ** CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Gene == Gene Tiso_gene_18040 == * Synonym(s): == Reactions associated == * RXN66-482 ** pantograph-esiliculosus * TRANSENOYLCOARED-RXN ** panto...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19150 CPD-19150] ==
+
== Gene Tiso_gene_18040 ==
* smiles:
+
** CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=ZSJRXHRCABOSNC-SHJPOGNXSA-J
+
* common name:
+
** (2E,5Z)-dodecenoyl-CoA
+
* molecular weight:
+
** 941.776   
+
 
* Synonym(s):
 
* Synonym(s):
** 12:2-Δ2,Δ5-CoA
 
** 2-trans,5-cis-dodecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17797]]
+
* [[RXN66-482]]
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[esiliculosus]]
* [[RXN-17796]]
+
* [[TRANSENOYLCOARED-RXN]]
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY66-389]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=RXN66-482|TRANSENOYLCOARED-RXN}}
{{#set: inchi key=InChIKey=ZSJRXHRCABOSNC-SHJPOGNXSA-J}}
+
{{#set: pathway associated=PWY66-389}}
{{#set: common name=(2E,5Z)-dodecenoyl-CoA}}
+
{{#set: molecular weight=941.776    }}
+
{{#set: common name=12:2-Δ2,Δ5-CoA|2-trans,5-cis-dodecenoyl-CoA}}
+
{{#set: consumed by=RXN-17797}}
+
{{#set: produced by=RXN-17796}}
+

Revision as of 19:43, 18 March 2018

Gene Tiso_gene_18040

  • Synonym(s):

Reactions associated

Pathways associated

External links