Difference between revisions of "CPD-6993"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13040 CPD-13040] == * smiles: ** CCCC(OCC(OC(CCC)=O)CO)=O * inchi key: ** InChIKey=AWHAUPZH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15377 CPD-15377] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=PYMYPHUHKU...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15377 CPD-15377] == |
* smiles: | * smiles: | ||
| − | ** | + | ** [CH](=O)C(O)C(O)C(O)CO |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=PYMYPHUHKUWMLA-VPENINKCSA-N |
* common name: | * common name: | ||
| − | ** | + | ** aldehydo-D-xylose |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 150.131 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** linear D-xylose |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-14503]] | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=644160 644160] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15936 15936] |
| − | {{#set: smiles= | + | * METABOLIGHTS : MTBLC15936 |
| − | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB60254 |
| − | {{#set: common name= | + | {{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-VPENINKCSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=aldehydo-D-xylose}} |
| − | {{#set: | + | {{#set: molecular weight=150.131 }} |
| + | {{#set: common name=linear D-xylose}} | ||
| + | {{#set: reversible reaction associated=RXN-14503}} | ||
Revision as of 18:44, 18 March 2018
Contents
Metabolite CPD-15377
- smiles:
- [CH](=O)C(O)C(O)C(O)CO
- inchi key:
- InChIKey=PYMYPHUHKUWMLA-VPENINKCSA-N
- common name:
- aldehydo-D-xylose
- molecular weight:
- 150.131
- Synonym(s):
- linear D-xylose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.
