Difference between revisions of "5-HYDROXY-CTP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] == * smiles: ** C(O)C1(OCC(O)C(O)C(O)1) * inchi key: ** InChIKey=MPCAJMNYNOG...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FTHFO FTHFO] == * direction: ** LEFT-TO-RIGHT * common name: ** 10-formyltetrahydrofolate:NADP+ oxi...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FTHFO FTHFO] ==
−
* smiles:
+
* direction:
−
** C(O)C1(OCC(O)C(O)C(O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N
+
 
* common name:
 
* common name:
−
** 1,5-anhydro-D-mannitol
+
** 10-formyltetrahydrofolate:NADP+ oxidoreductase
−
* molecular weight:
+
−
** 164.158   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 1,5-anhydromannitol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-13064]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[NADP]][c] '''+''' 1.0 [[10-FORMYL-THF]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NADPH]][c] '''+''' 1.0 [[THF]][c] '''+''' 1.0 [[CARBON-DIOXIDE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 NADP+[c] '''+''' 1.0 10-formyl-tetrahydrofolate mono-L-glutamate[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 H+[c] '''+''' 1.0 NADPH[c] '''+''' 1.0 tetrahydropteroyl mono-L-glutamate[c] '''+''' 1.0 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_3513]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445184 445184]
+
{{#set: common name=10-formyltetrahydrofolate:NADP+ oxidoreductase}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_3513}}
−
** [http://www.chemspider.com/Chemical-Structure.392897.html 392897]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49182 49182]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16538 C16538]
+
−
{{#set: smiles=C(O)C1(OCC(O)C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N}}
+
−
{{#set: common name=1,5-anhydro-D-mannitol}}
+
−
{{#set: molecular weight=164.158    }}
+
−
{{#set: common name=1,5-anhydromannitol}}
+
−
{{#set: consumed by=RXN-13064}}
+

Revision as of 18:46, 18 March 2018

Reaction FTHFO

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 10-formyltetrahydrofolate:NADP+ oxidoreductase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 NADP+[c] + 1.0 10-formyl-tetrahydrofolate mono-L-glutamate[c] + 1.0 H2O[c] => 1.0 H+[c] + 1.0 NADPH[c] + 1.0 tetrahydropteroyl mono-L-glutamate[c] + 1.0 CO2[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=5-HYDROXY-CTP&oldid=26665"