Difference between revisions of "Tiso gene 13230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13010 CPD-13010] == * smiles: ** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O * i...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7772 RXN-7772] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/5.1.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13010 CPD-13010] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7772 RXN-7772] ==
−
* smiles:
+
* direction:
−
** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=RUIUIJSMLKJUDC-ZDUSSCGKSA-N
+
** [http://enzyme.expasy.org/EC/5.1.3 EC-5.1.3]
−
* common name:
+
−
** 3'-monoiodothyronine
+
−
* molecular weight:
+
−
** 399.184   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-tyrosine, O-(4-hydroxy-3-iodophenyl)-
 
−
** 3'-T1
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-12037]]
+
** 1 [[CPD-7078]][c] '''<=>''' 1 [[GDP-L-GALACTOSE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 GDP-&beta;-L-gulose[c] '''<=>''' 1 GDP-&beta;-L-galactose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_6621]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986170 50986170]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07673 R07673]
−
{{#set: smiles=C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O}}
+
{{#set: direction=REVERSIBLE}}
−
{{#set: inchi key=InChIKey=RUIUIJSMLKJUDC-ZDUSSCGKSA-N}}
+
{{#set: ec number=EC-5.1.3}}
−
{{#set: common name=3'-monoiodothyronine}}
+
{{#set: gene associated=Tiso_gene_6621}}
−
{{#set: molecular weight=399.184    }}
+
{{#set: in pathway=}}
−
{{#set: common name=L-tyrosine, O-(4-hydroxy-3-iodophenyl)-|3'-T1}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: produced by=RXN-12037}}
+
{{#set: reconstruction source=orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Revision as of 18:46, 18 March 2018

Reaction RXN-7772

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 GDP-β-L-gulose[c] <=> 1 GDP-β-L-galactose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13230&oldid=26707"