Difference between revisions of "DNA-N"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=VINYLACETYL-COA-DELTA-ISOMERASE-RXN VINYLACETYL-COA-DELTA-ISOMERASE-RXN] == * direction: ** REVERSI...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])O * inchi key: ** InChIKey=JUCRENB...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == |
− | * | + | * smiles: |
− | ** | + | ** CCC(C([O-])=O)C(C(=O)[O-])O |
+ | * inchi key: | ||
+ | ** InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** 3-ethylmalate |
− | * | + | * molecular weight: |
− | ** | + | ** 160.126 |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-14986]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-18210]] | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145023 21145023] |
− | * LIGAND- | + | * CHEMSPIDER: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.chemspider.com/Chemical-Structure.20015785.html 20015785] |
− | {{#set: | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57425 57425] | |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01989 C01989] |
− | {{#set: | + | {{#set: smiles=CCC(C([O-])=O)C(C(=O)[O-])O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L}} |
− | {{#set: | + | {{#set: common name=3-ethylmalate}} |
− | {{#set: | + | {{#set: molecular weight=160.126 }} |
+ | {{#set: consumed by=RXN-14986}} | ||
+ | {{#set: reversible reaction associated=RXN-18210}} |
Revision as of 18:46, 18 March 2018
Contents
Metabolite CPD-1130
- smiles:
- CCC(C([O-])=O)C(C(=O)[O-])O
- inchi key:
- InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L
- common name:
- 3-ethylmalate
- molecular weight:
- 160.126
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC(C([O-])=O)C(C(=O)[O-])O" cannot be used as a page name in this wiki.