Difference between revisions of "Tiso gene 11758"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_19802 == * Synonym(s): == Reactions associated == * TRANS-RXN-233 ** pantograph-creinhardtii * TRANS-RXN-76 ** pantograp...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] == * smiles: ** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2)) * inc...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_19802 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] ==
 +
* smiles:
 +
** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))
 +
* inchi key:
 +
** InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M
 +
* common name:
 +
** 6-sulfatoxymelatonin
 +
* molecular weight:
 +
** 327.331   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6-sulphatoxymelatonin
 +
** 6-hydroxymelatoninsulfate
 +
** 6-hydroxymelatonin sulfate ester
 +
** acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[TRANS-RXN-233]]
+
== Reaction(s) known to produce the compound ==
−
** [[pantograph]]-[[creinhardtii]]
+
* [[RXN-11058]]
−
* [[TRANS-RXN-76]]
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[TRANS-RXN-77]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: reaction associated=TRANS-RXN-233|TRANS-RXN-76|TRANS-RXN-77}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=38988602 38988602]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.58606.html 58606]
 +
* HMDB : HMDB41815
 +
{{#set: smiles=CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))}}
 +
{{#set: inchi key=InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M}}
 +
{{#set: common name=6-sulfatoxymelatonin}}
 +
{{#set: molecular weight=327.331    }}
 +
{{#set: common name=6-sulphatoxymelatonin|6-hydroxymelatoninsulfate|6-hydroxymelatonin sulfate ester|acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-}}
 +
{{#set: produced by=RXN-11058}}

Revision as of 18:46, 18 March 2018

Metabolite CPD-12015

  • smiles:
    • CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))
  • inchi key:
    • InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M
  • common name:
    • 6-sulfatoxymelatonin
  • molecular weight:
    • 327.331
  • Synonym(s):
    • 6-sulphatoxymelatonin
    • 6-hydroxymelatoninsulfate
    • 6-hydroxymelatonin sulfate ester
    • acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11758&oldid=26730"