Difference between revisions of "Tiso gene 7201"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_4191 == * left end position: ** 11562 * transcription direction: ** NEGATIVE * right end position: ** 14920 * centisome position: ** 75.910...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7422 CPD-7422] == * smiles: ** CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_4191 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7422 CPD-7422] ==
* left end position:
+
* smiles:
** 11562
+
** CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=IGABZIVJSNQMPZ-DWQNOKSTSA-N
* right end position:
+
* common name:
** 14920
+
** α-zeacarotene
* centisome position:
+
* molecular weight:
** 75.91097    
+
** 538.898    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ACYLCOASYN-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
== Reaction(s) of unknown directionality ==
***ec-number
+
* [[RXN-8040]]
** experimental_annotation
+
***ec-number
+
* [[LINOLENOYL-RXN]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[R223-RXN]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-12184]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-12978]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-13290]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-13614]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16380]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16389]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16393]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16401]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16402]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16415]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16418]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-7904]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9623]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
** [[pantograph]]-[[athaliana]]
+
* [[RXN-9644]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9673]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN0-7238]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN0-7239]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN0-7248]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN66-469]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN66-477]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN66-480]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN66-483]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[RXN66-484]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
* [[TRANS-RXN0-623]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[PWY-6920]]
+
* [[P221-PWY]]
+
* [[PWY-321]]
+
* [[PWY-5972]]
+
* [[PWY-5971]]
+
* [[PWY-7033]]
+
* [[PWY-5136]]
+
* [[PWY66-389]]
+
* [[PWY-7288]]
+
* [[PWY-6733]]
+
* [[PWY-7094]]
+
* [[PWY66-391]]
+
* [[FAO-PWY]]
+
* [[PWY-1121]]
+
* [[PWY-6873]]
+
* [[PWY-5147]]
+
* [[PWY-5143]]
+
* [[PWY-5885]]
+
* [[PWY-7724]]
+
* [[PWY-6001]]
+
* [[PWY-6000]]
+
* [[PWY-7049]]
+
* [[PWY66-387]]
+
* [[PWY-5989]]
+
* [[PWY-6803]]
+
* [[PWY66-388]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=11562}}
+
* LIPID_MAPS : LMPR01070285
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
{{#set: right end position=14920}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6441660 6441660]
{{#set: centisome position=75.91097   }}
+
* HMDB : HMDB36909
{{#set: reaction associated=ACYLCOASYN-RXN|LINOLENOYL-RXN|R223-RXN|RXN-12184|RXN-12978|RXN-13290|RXN-13614|RXN-16380|RXN-16389|RXN-16393|RXN-16401|RXN-16402|RXN-16415|RXN-16418|RXN-7904|RXN-9623|RXN-9644|RXN-9673|RXN0-7238|RXN0-7239|RXN0-7248|RXN66-469|RXN66-477|RXN66-480|RXN66-483|RXN66-484|TRANS-RXN0-623}}
+
* LIGAND-CPD:
{{#set: pathway associated=PWY-6920|P221-PWY|PWY-321|PWY-5972|PWY-5971|PWY-7033|PWY-5136|PWY66-389|PWY-7288|PWY-6733|PWY-7094|PWY66-391|FAO-PWY|PWY-1121|PWY-6873|PWY-5147|PWY-5143|PWY-5885|PWY-7724|PWY-6001|PWY-6000|PWY-7049|PWY66-387|PWY-5989|PWY-6803|PWY66-388}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C14146 C14146]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.4945802.html 4945802]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35063 35063]
 +
{{#set: smiles=CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C}}
 +
{{#set: inchi key=InChIKey=IGABZIVJSNQMPZ-DWQNOKSTSA-N}}
 +
{{#set: common name=α-zeacarotene}}
 +
{{#set: molecular weight=538.898   }}
 +
{{#set: reversible reaction associated=RXN-8040}}

Revision as of 18:47, 18 March 2018

Metabolite CPD-7422

  • smiles:
    • CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C
  • inchi key:
    • InChIKey=IGABZIVJSNQMPZ-DWQNOKSTSA-N
  • common name:
    • α-zeacarotene
  • molecular weight:
    • 538.898
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links