Difference between revisions of "THYMINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15675 CPD-15675] == * smiles: ** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15560 RXN-15560] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15675 CPD-15675] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15560 RXN-15560] ==
* smiles:
+
* direction:
** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=OOSDLBAXVXKFIB-BJBRNGJVSA-J
+
** [http://enzyme.expasy.org/EC/2.3.2.26 EC-2.3.2.26]
* common name:
+
** 2-trans-6-trans-tridecadienoyl-CoA
+
* molecular weight:
+
** 955.803   
+
 
* Synonym(s):
 
* Synonym(s):
** 2E, 6E-tridecadienoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-14785]]
+
** 1 [[Protein-L-lysine]][c] '''+''' 1 [[S-ubiquitinyl-HECT-E3-UCP-L-cysteine]][c] '''=>''' 1 [[HECT-Ubiquitin-carrier-protein-E3-L-cys]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PROTEIN-N-UBIQUITYL-LYSINE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a [protein]-L-lysine[c] '''+''' 1 an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine[c] '''=>''' 1 a [HECT-type E3 ubiquitin transferase]-L-cysteine[c] '''+''' 1 H+[c] '''+''' 1 an N6-monoubiquitinyl-[protein]-L-lysine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7511]], protein ubiquitylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7511 PWY-7511]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658431 90658431]
+
{{#set: ec number=EC-2.3.2.26}}
{{#set: smiles=CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: in pathway=PWY-7511}}
{{#set: inchi key=InChIKey=OOSDLBAXVXKFIB-BJBRNGJVSA-J}}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=2-trans-6-trans-tridecadienoyl-CoA}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: molecular weight=955.803    }}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=2E, 6E-tridecadienoyl-CoA}}
+
{{#set: produced by=RXN-14785}}
+

Revision as of 18:47, 18 March 2018

Reaction RXN-15560

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7511, protein ubiquitylation: PWY-7511
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links