Difference between revisions of "Tiso gene 12787"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETOGLUTARATE 2-KETOGLUTARATE] == * smiles: ** C(CC([O-])=O)C(=O)C([O-])=O * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=G3PD3 G3PD3] == * direction: ** LEFT-TO-RIGHT * common name: ** glycerol-3-phosphate dehydrogenase...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=G3PD3 G3PD3] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** glycerol-3-phosphate dehydrogenase (FAD) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * | + | ** 1.0 [[FADH2]][c] '''+''' 1.0 [[DIHYDROXY-ACETONE-PHOSPHATE]][c] '''=>''' 1.0 [[GLYCEROL-3P]][c] '''+''' 1.0 [[FAD]][c] |
− | * | + | * With common name(s): |
− | + | ** 1.0 FADH2[c] '''+''' 1.0 glycerone phosphate[c] '''=>''' 1.0 sn-glycerol 3-phosphate[c] '''+''' 1.0 FAD[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | + | * [[Tiso_gene_15777]] | |
− | + | ** [[pantograph]]-[[creinhardtii]] | |
− | + | == Pathways == | |
− | + | == Reconstruction information == | |
− | + | * Category: [[orthology]] | |
− | + | ** Source: [[orthology-creinhardtii]] | |
− | + | *** Tool: [[pantograph]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | + | ||
− | * | + | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=glycerol-3-phosphate dehydrogenase (FAD)}} | |
− | + | {{#set: gene associated=Tiso_gene_15777}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:47, 18 March 2018
Contents
Reaction G3PD3
- direction:
- LEFT-TO-RIGHT
- common name:
- glycerol-3-phosphate dehydrogenase (FAD)
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 FADH2[c] + 1.0 DIHYDROXY-ACETONE-PHOSPHATE[c] => 1.0 GLYCEROL-3P[c] + 1.0 FAD[c]
- With common name(s):
- 1.0 FADH2[c] + 1.0 glycerone phosphate[c] => 1.0 sn-glycerol 3-phosphate[c] + 1.0 FAD[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii