Difference between revisions of "Tiso gene 16258"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_10984 == * left end position: ** 6772 * transcription direction: ** POSITIVE * right end position: ** 8075 * centisome position: ** 83.1226...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_10984 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] ==
−
* left end position:
+
* smiles:
−
** 6772
+
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
−
* right end position:
+
* common name:
−
** 8075
+
** isofucosterol
−
* centisome position:
+
* molecular weight:
−
** 83.12262    
+
** 412.698    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ACYL-COA-HYDROLASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-4210]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-10708]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-735]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=6772}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281326 5281326]
−
{{#set: right end position=8075}}
+
* LIGAND-CPD:
−
{{#set: centisome position=83.12262    }}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08821 C08821]
−
{{#set: reaction associated=ACYL-COA-HYDROLASE-RXN|RXN-10708}}
+
* HMDB : HMDB02374
−
{{#set: pathway associated=PWY-735}}
+
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N}}
 +
{{#set: common name=isofucosterol}}
 +
{{#set: molecular weight=412.698    }}
 +
{{#set: produced by=RXN-4210}}

Revision as of 18:48, 18 March 2018

Metabolite CPD-4127

  • smiles:
    • CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
  • common name:
    • isofucosterol
  • molecular weight:
    • 412.698
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16258&oldid=26982"