Difference between revisions of "Histone-L-lysine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_15293 == * left end position: ** 3071 * transcription direction: ** POSITIVE * right end position: ** 4853 * centisome position: ** 60.0156...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_15293 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] ==
−
* left end position:
+
* smiles:
−
** 3071
+
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J
−
* right end position:
+
* common name:
−
** 4853
+
** (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
−
* centisome position:
+
* molecular weight:
−
** 60.015636    
+
** 519.151    
 
* Synonym(s):
 
* Synonym(s):
 +
** 3',8-cH2GTP
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-8340]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3071}}
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))}}
−
{{#set: transcription direction=POSITIVE}}
+
{{#set: inchi key=InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J}}
−
{{#set: right end position=4853}}
+
{{#set: common name=(8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate}}
−
{{#set: centisome position=60.015636   }}
+
{{#set: molecular weight=519.151   }}
−
{{#set: reaction associated=HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN}}
+
{{#set: common name=3',8-cH2GTP}}
 +
{{#set: produced by=RXN-8340}}

Revision as of 18:48, 18 March 2018

Metabolite CPD-19179

  • smiles:
    • C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))
  • inchi key:
    • InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J
  • common name:
    • (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
  • molecular weight:
    • 519.151
  • Synonym(s):
    • 3',8-cH2GTP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Histone-L-lysine&oldid=27037"