Difference between revisions of "Tiso gene 4284"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1P RIBOSE-1P] == * smiles: ** C(O)C1(C(O)C(O)C(OP(=O)([O-])[O-])O1) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Tiso_gene_10337 == * Synonym(s): == Reactions associated == * RXN66-482 ** pantograph-esiliculosus * TRANSENOYLCOARED-RXN ** panto...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10337 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RXN66-482]] | |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
− | + | * [[TRANSENOYLCOARED-RXN]] | |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[PWY66-389]] |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN66-482|TRANSENOYLCOARED-RXN}} | |
− | + | {{#set: pathway associated=PWY66-389}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 18:49, 18 March 2018
Gene Tiso_gene_10337
- Synonym(s):