Difference between revisions of "Apo-Propionyl-CoA-CO2-ligases"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])=O) * inc...") |
(Created page with "Category:Gene == Gene Tiso_gene_9243 == * left end position: ** 3735 * transcription direction: ** NEGATIVE * right end position: ** 9449 * centisome position: ** 39.35307...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_9243 == |
− | * | + | * left end position: |
− | ** | + | ** 3735 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 9449 |
− | * | + | * centisome position: |
− | ** | + | ** 39.353073 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[ATPASE-RXN]] |
− | + | ** in-silico_annotation | |
− | * [[ | + | ***ec-number |
− | == | + | * [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]] |
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-12195]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-12196]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN0-5462]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7184]] | ||
+ | * [[PWY-7198]] | ||
+ | * [[PWY-6545]] | ||
+ | * [[PWY-7210]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3735}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=9449}} | |
− | + | {{#set: centisome position=39.353073 }} | |
− | + | {{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}} | |
− | + | {{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:49, 18 March 2018
Gene Tiso_gene_9243
- left end position:
- 3735
- transcription direction:
- NEGATIVE
- right end position:
- 9449
- centisome position:
- 39.353073
- Synonym(s):
Reactions associated
- ATPASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- NUCLEOSIDE-TRIPHOSPHATASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-12195
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-12196
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN0-5462
- in-silico_annotation
- ec-number
- in-silico_annotation