Difference between revisions of "RXN0-308"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquitin-C-Terminal-Glycine Ubiquitin-C-Terminal-Glycine] == * common name: ** a [ubiquitin] C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] == * smiles: ** C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-] * inchi key: ** InChIKey...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquitin-C-Terminal-Glycine Ubiquitin-C-Terminal-Glycine] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] ==
 +
* smiles:
 +
** C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-]
 +
* inchi key:
 +
** InChIKey=WRGKTDWHJSBCJR-UHFFFAOYSA-L
 
* common name:
 
* common name:
** a [ubiquitin] C-terminal glycine
+
** 3-isopropyl-6-(methylthio)-2-oxohexanoate
 +
* molecular weight:
 +
** 218.224   
 
* Synonym(s):
 
* Synonym(s):
** a C-terminal [ubiquitin]-glycine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
* [[RXN-18209]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-18208]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a [ubiquitin] C-terminal glycine}}
+
{{#set: smiles=C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-]}}
{{#set: common name=a C-terminal [ubiquitin]-glycine}}
+
{{#set: inchi key=InChIKey=WRGKTDWHJSBCJR-UHFFFAOYSA-L}}
{{#set: consumed by=UBIQUITIN--PROTEIN-LIGASE-RXN}}
+
{{#set: common name=3-isopropyl-6-(methylthio)-2-oxohexanoate}}
 +
{{#set: molecular weight=218.224    }}
 +
{{#set: consumed by=RXN-18209}}
 +
{{#set: reversible reaction associated=RXN-18208}}

Revision as of 18:49, 18 March 2018

Metabolite CPD-19491

  • smiles:
    • C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-]
  • inchi key:
    • InChIKey=WRGKTDWHJSBCJR-UHFFFAOYSA-L
  • common name:
    • 3-isopropyl-6-(methylthio)-2-oxohexanoate
  • molecular weight:
    • 218.224
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-" cannot be used as a page name in this wiki.