Difference between revisions of "Tiso gene 10778"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_7966 == * left end position: ** 203 * transcription direction: ** NEGATIVE * right end position: ** 10515 * centisome position: ** 1.905208...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17401 CPD-17401] == * smiles: ** CCC=CCCC(O)CC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17401 CPD-17401] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC=CCCC(O)CC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=FGCWEBKTQLBCLR-JRSZCNINSA-J |
| − | * | + | * common name: |
| − | ** | + | ** 3-oxo-auricoloyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1083.973 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-oxo-(11Z,17Z)-14R-hydroxy-icosa-11,17-dienoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-16154]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819742 91819742] |
| − | {{#set: | + | {{#set: smiles=CCC=CCCC(O)CC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=FGCWEBKTQLBCLR-JRSZCNINSA-J}} |
| − | {{#set: | + | {{#set: common name=3-oxo-auricoloyl-CoA}} |
| − | {{#set: | + | {{#set: molecular weight=1083.973 }} |
| + | {{#set: common name=3-oxo-(11Z,17Z)-14R-hydroxy-icosa-11,17-dienoyl-CoA}} | ||
| + | {{#set: consumed by=RXN-16154}} | ||
Revision as of 18:49, 18 March 2018
Contents
Metabolite CPD-17401
- smiles:
- CCC=CCCC(O)CC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=FGCWEBKTQLBCLR-JRSZCNINSA-J
- common name:
- 3-oxo-auricoloyl-CoA
- molecular weight:
- 1083.973
- Synonym(s):
- 3-oxo-(11Z,17Z)-14R-hydroxy-icosa-11,17-dienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCCC(O)CC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
