Difference between revisions of "CPD-11529"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] == * smiles: ** C(C(=O)[O-])C(O)[CH]=O * inchi key: ** InChIKey=QWHDXIUUXW...")
(Created page with "Category:Gene == Gene Tiso_gene_12198 == * left end position: ** 73 * transcription direction: ** NEGATIVE * right end position: ** 5134 * centisome position: ** 1.0102408...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] ==
+
== Gene Tiso_gene_12198 ==
* smiles:
+
* left end position:
** C(C(=O)[O-])C(O)[CH]=O
+
** 73
* inchi key:
+
* transcription direction:
** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
+
** NEGATIVE
* common name:
+
* right end position:
** L-malic semialdehyde
+
** 5134
* molecular weight:
+
* centisome position:
** 117.081    
+
** 1.0102408    
 
* Synonym(s):
 
* Synonym(s):
** (3R)-3-hydroxy-4-oxobutanoate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-6002]]
+
* [[5.4.99.17-RXN]]
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7072]]
 +
* [[PWY-6098]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=73}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}}
+
{{#set: right end position=5134}}
{{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}}
+
{{#set: centisome position=1.0102408   }}
{{#set: common name=L-malic semialdehyde}}
+
{{#set: reaction associated=5.4.99.17-RXN}}
{{#set: molecular weight=117.081   }}
+
{{#set: pathway associated=PWY-7072|PWY-6098}}
{{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}}
+
{{#set: consumed by=RXN-6002}}
+

Revision as of 18:49, 18 March 2018

Gene Tiso_gene_12198

  • left end position:
    • 73
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5134
  • centisome position:
    • 1.0102408
  • Synonym(s):

Reactions associated

Pathways associated

External links