Difference between revisions of "Tiso gene 16240"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11529 CPD-11529] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UG4E UG4E] == * direction: ** REVERSIBLE * common name: ** UDP-glucose 4-epimerase * Synonym(s): =...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11529 CPD-11529] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=UG4E UG4E] ==
* smiles:
+
* direction:
** CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** REVERSIBLE
* inchi key:
+
** InChIKey=WQKKCPPNDKSAIU-PCDAEQFSSA-J
+
 
* common name:
 
* common name:
** jasmonoyl-CoA
+
** UDP-glucose 4-epimerase
* molecular weight:
+
** 955.76   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10708]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CPD-12575]][c] '''<=>''' 1.0 [[CPD-14553]][c]
* [[RXN-10701]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1.0 UDP-&alpha;-D-glucose[c] '''<=>''' 1.0 UDP-&alpha;-D-galactose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_9823]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237154 44237154]
+
{{#set: common name=UDP-glucose 4-epimerase}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: gene associated=Tiso_gene_9823}}
{{#set: inchi key=InChIKey=WQKKCPPNDKSAIU-PCDAEQFSSA-J}}
+
{{#set: in pathway=}}
{{#set: common name=jasmonoyl-CoA}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=955.76    }}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: consumed by=RXN-10708}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: produced by=RXN-10701}}
+

Revision as of 19:50, 18 March 2018

Reaction UG4E

  • direction:
    • REVERSIBLE
  • common name:
    • UDP-glucose 4-epimerase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 UDP-α-D-glucose[c] <=> 1.0 UDP-α-D-galactose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links