Difference between revisions of "RXN66-483"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_38 == * left end position: ** 42206 * transcription direction: ** NEGATIVE * right end position: ** 46733 * centisome position: ** 85.97152...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] == * smiles: ** C(=O)([O-])C1(C=CC(=CC=1)N) * inchi key: **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])C1(C=CC(=CC=1)N) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-M |
− | * | + | * common name: |
− | ** | + | ** 4-aminobenzoate |
− | * | + | * molecular weight: |
− | ** | + | ** 136.13 |
* Synonym(s): | * Synonym(s): | ||
+ | ** para-aminobenzoic acid | ||
+ | ** p-aminobenzoic acid | ||
+ | ** para-aminobenzoate | ||
+ | ** p-aminobenzoate | ||
+ | ** 4-aminobenzoic acid | ||
+ | ** pABA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[H2PTEROATESYNTH-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[ADCLY-RXN]] | |
− | + | * [[RXN-14226]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 150-13-0 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4876 4876] |
− | {{#set: | + | * HMDB : HMDB01392 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00568 C00568] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4710.html 4710] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17836 17836] | ||
+ | * BIGG : 4abz | ||
+ | {{#set: smiles=C(=O)([O-])C1(C=CC(=CC=1)N)}} | ||
+ | {{#set: inchi key=InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=4-aminobenzoate}} | ||
+ | {{#set: molecular weight=136.13 }} | ||
+ | {{#set: common name=para-aminobenzoic acid|p-aminobenzoic acid|para-aminobenzoate|p-aminobenzoate|4-aminobenzoic acid|pABA}} | ||
+ | {{#set: consumed by=H2PTEROATESYNTH-RXN}} | ||
+ | {{#set: reversible reaction associated=ADCLY-RXN|RXN-14226}} |
Revision as of 18:50, 18 March 2018
Contents
Metabolite P-AMINO-BENZOATE
- smiles:
- C(=O)([O-])C1(C=CC(=CC=1)N)
- inchi key:
- InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-M
- common name:
- 4-aminobenzoate
- molecular weight:
- 136.13
- Synonym(s):
- para-aminobenzoic acid
- p-aminobenzoic acid
- para-aminobenzoate
- p-aminobenzoate
- 4-aminobenzoic acid
- pABA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 150-13-0
- PUBCHEM:
- HMDB : HMDB01392
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 4abz
"C(=O)([O-])C1(C=CC(=CC=1)N)" cannot be used as a page name in this wiki.