Difference between revisions of "Trans-delta2-arachidoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TGUAt TGUAt] == * direction: ** REVERSIBLE * common name: ** nucleobase transport, thioguanine (ext...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TGUAt TGUAt] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J
+
 
* common name:
 
* common name:
−
** (7Z)-hexadecenoyl-CoA
+
** nucleobase transport, thioguanine (extracellular)
−
* molecular weight:
+
−
** 999.899   
+
 
* Synonym(s):
 
* Synonym(s):
−
** cis-hexadec-7-enoyl-CoA
 
−
** (7Z)-hexadec-7-enoyl-CoA
 
−
** 16:1 cis-7
 
−
** 16:1(n-9)
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17779]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CPD-5721]][e] '''<=>''' 1.0 [[CPD-5721]][c]
−
* [[RXN-17778]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 thioguanine[e] '''<=>''' 1.0 thioguanine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_18433]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[Tiso_gene_18556]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[Tiso_gene_6578]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=REVERSIBLE}}
−
{{#set: inchi key=InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J}}
+
{{#set: common name=nucleobase transport, thioguanine (extracellular)}}
−
{{#set: common name=(7Z)-hexadecenoyl-CoA}}
+
{{#set: gene associated=Tiso_gene_18433|Tiso_gene_18556|Tiso_gene_6578}}
−
{{#set: molecular weight=999.899    }}
+
{{#set: in pathway=}}
−
{{#set: common name=cis-hexadec-7-enoyl-CoA|(7Z)-hexadec-7-enoyl-CoA|16:1 cis-7|16:1(n-9)}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: consumed by=RXN-17779}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: produced by=RXN-17778}}
+
{{#set: reconstruction tool=pantograph}}

Revision as of 19:51, 18 March 2018

Reaction TGUAt

  • direction:
    • REVERSIBLE
  • common name:
    • nucleobase transport, thioguanine (extracellular)
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 thioguanine[e] <=> 1.0 thioguanine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Trans-delta2-arachidoyl-ACPs&oldid=27319"