Difference between revisions of "Tiso gene 6340"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARYLFORMAMIDASE-RXN ARYLFORMAMIDASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://e...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == * smiles: ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O * inchi...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARYLFORMAMIDASE-RXN ARYLFORMAMIDASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.5.1.9 EC-3.5.1.9]
+
** InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M
 +
* common name:
 +
** D-nopaline
 +
* molecular weight:
 +
** 303.294   
 
* Synonym(s):
 
* Synonym(s):
 +
** N2-(D-1,3-dicarboxypropyl)-L-arginine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[WATER]][c] '''+''' 1 [[N-FORMYLKYNURENINE]][c] '''=>''' 1 [[FORMATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-14736]][c]
+
* [[1.5.1.19-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 N-formylkynurenine[c] '''=>''' 1 formate[c] '''+''' 1 H+[c] '''+''' 1 L-kynurenine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_16921]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
* [[PWY-7765]], 3-hydroxy-4-methyl-anthranilate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7765 PWY-7765]
+
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-5651]], L-tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5651 PWY-5651]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
* [[TRPCAT-PWY]], L-tryptophan degradation I (via anthranilate): [http://metacyc.org/META/NEW-IMAGE?object=TRPCAT-PWY TRPCAT-PWY]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-6309]], L-tryptophan degradation XI (mammalian, via kynurenine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6309 PWY-6309]
+
−
** '''9''' reactions found over '''17''' reactions in the full pathway
+
−
* [[PWY-7717]], 3-hydroxy-4-methyl-anthranilate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7717 PWY-7717]
+
−
** '''2''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13009 13009]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791983 49791983]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01959 R01959]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58074 58074]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-3.5.1.9}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01682 C01682]
−
{{#set: gene associated=Tiso_gene_16921}}
+
{{#set: smiles=C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O}}
−
{{#set: in pathway=PWY-7765|PWY-5651|TRPCAT-PWY|PWY-6309|PWY-7717}}
+
{{#set: inchi key=InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=D-nopaline}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=303.294    }}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: common name=N2-(D-1,3-dicarboxypropyl)-L-arginine}}
 +
{{#set: produced by=1.5.1.19-RXN}}

Revision as of 18:51, 18 March 2018

Metabolite CPD-308

  • smiles:
    • C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O
  • inchi key:
    • InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M
  • common name:
    • D-nopaline
  • molecular weight:
    • 303.294
  • Synonym(s):
    • N2-(D-1,3-dicarboxypropyl)-L-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6340&oldid=27384"