Difference between revisions of "3.5.1.27-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == * smiles: ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-5P PYRIDOXINE-5P] == * smiles: ** CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO) * inchi k...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-5P PYRIDOXINE-5P] == |
* smiles: | * smiles: | ||
| − | ** C([O-]) | + | ** CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=WHOMFKWHIQZTHY-UHFFFAOYSA-L |
* common name: | * common name: | ||
| − | ** | + | ** pyridoxine 5'-phosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 247.144 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** pyridoxol 5'-phosphate |
| + | ** pyridoxine 5-phosphate | ||
| + | ** pyridoxine phosphate | ||
| + | ** pyridoxine-5P | ||
| + | ** pyridoxine-P | ||
| + | ** [5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PNPOXI-RXN]] | ||
| + | * [[RXN-14181]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PNKIN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 447-05-2 | ||
| + | * METABOLIGHTS : MTBLC58589 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24794348 24794348] |
| − | * | + | * HMDB : HMDB01319 |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00627 C00627] |
| − | {{#set: smiles=C([O-]) | + | * CHEBI: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58589 58589] |
| − | {{#set: common name= | + | * BIGG : pdx5p |
| − | {{#set: molecular weight= | + | {{#set: smiles=CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO)}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=WHOMFKWHIQZTHY-UHFFFAOYSA-L}} |
| − | {{#set: produced by= | + | {{#set: common name=pyridoxine 5'-phosphate}} |
| + | {{#set: molecular weight=247.144 }} | ||
| + | {{#set: common name=pyridoxol 5'-phosphate|pyridoxine 5-phosphate|pyridoxine phosphate|pyridoxine-5P|pyridoxine-P|[5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl phosphate}} | ||
| + | {{#set: consumed by=PNPOXI-RXN|RXN-14181}} | ||
| + | {{#set: produced by=PNKIN-RXN}} | ||
Revision as of 19:52, 18 March 2018
Contents
Metabolite PYRIDOXINE-5P
- smiles:
- CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO)
- inchi key:
- InChIKey=WHOMFKWHIQZTHY-UHFFFAOYSA-L
- common name:
- pyridoxine 5'-phosphate
- molecular weight:
- 247.144
- Synonym(s):
- pyridoxol 5'-phosphate
- pyridoxine 5-phosphate
- pyridoxine phosphate
- pyridoxine-5P
- pyridoxine-P
- [5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 447-05-2
- METABOLIGHTS : MTBLC58589
- PUBCHEM:
- HMDB : HMDB01319
- LIGAND-CPD:
- CHEBI:
- BIGG : pdx5p
"CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO)" cannot be used as a page name in this wiki.
"5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl phosphate" cannot be used as a page name in this wiki.
