Difference between revisions of "Tiso gene 7688"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_17237 == * left end position: ** 74 * transcription direction: ** POSITIVE * right end position: ** 3684 * centisome position: ** 1.92859...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-695 CPD-695] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_17237 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-695 CPD-695] ==
−
* left end position:
+
* smiles:
−
** 74
+
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L
−
* right end position:
+
* common name:
−
** 3684
+
** gibberellin A53
−
* centisome position:
+
* molecular weight:
−
** 1.92859    
+
** 346.422    
 
* Synonym(s):
 
* Synonym(s):
 +
** GA53
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
+
* [[RXN1F-167]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[RXN-12445]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=74}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203620 25203620]
−
{{#set: right end position=3684}}
+
* CHEBI:
−
{{#set: centisome position=1.92859   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27433 27433]
−
{{#set: reaction associated=NADPH-DEHYDROGENASE-FLAVIN-RXN|RXN-12445}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C06094 C06094]
 +
* HMDB : HMDB36895
 +
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
 +
{{#set: inchi key=InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L}}
 +
{{#set: common name=gibberellin A53}}
 +
{{#set: molecular weight=346.422   }}
 +
{{#set: common name=GA53}}
 +
{{#set: consumed by=RXN1F-167}}

Revision as of 19:52, 18 March 2018

Metabolite CPD-695

  • smiles:
    • C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • inchi key:
    • InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L
  • common name:
    • gibberellin A53
  • molecular weight:
    • 346.422
  • Synonym(s):
    • GA53

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7688&oldid=27460"