Difference between revisions of "PRADP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENINE ADENINE] == * smiles: ** C1(N)(N=CN=C2(NC=NC=12)) * inchi key: ** InChIKey=GFFGJBXGBJIS...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] == * smiles: ** CC(=O)C(O)COP(=O)([O-])[O-] * inchi...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=O)C(O)COP(=O)([O-])[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L |
* common name: | * common name: | ||
− | ** | + | ** 1-deoxy-L-glycero-tetrulose 4-phosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 182.069 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3,4-dihydroxy-2-butanone-4-phosphate |
− | ** | + | ** tetrolose phosphate |
+ | ** 3,4-dihydroxy-2-butanone-4-P | ||
+ | ** L-3,4-dihydroxybutan-2-one-4-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[DIOHBUTANONEPSYN-RXN]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658385 90658385] |
− | + | ||
− | + | ||
− | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.10739351.html 10739351] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50606 50606] |
− | * BIGG : | + | * BIGG : db4p |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15556 C15556] |
− | {{#set: common name= | + | {{#set: smiles=CC(=O)C(O)COP(=O)([O-])[O-]}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L}} |
− | {{#set: common name= | + | {{#set: common name=1-deoxy-L-glycero-tetrulose 4-phosphate}} |
− | + | {{#set: molecular weight=182.069 }} | |
− | {{#set: produced by= | + | {{#set: common name=3,4-dihydroxy-2-butanone-4-phosphate|tetrolose phosphate|3,4-dihydroxy-2-butanone-4-P|L-3,4-dihydroxybutan-2-one-4-phosphate}} |
+ | {{#set: produced by=DIOHBUTANONEPSYN-RXN}} |
Revision as of 19:52, 18 March 2018
Contents
Metabolite DIHYDROXY-BUTANONE-P
- smiles:
- CC(=O)C(O)COP(=O)([O-])[O-]
- inchi key:
- InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L
- common name:
- 1-deoxy-L-glycero-tetrulose 4-phosphate
- molecular weight:
- 182.069
- Synonym(s):
- 3,4-dihydroxy-2-butanone-4-phosphate
- tetrolose phosphate
- 3,4-dihydroxy-2-butanone-4-P
- L-3,4-dihydroxybutan-2-one-4-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)C(O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.