Difference between revisions of "3-DEHYDROQUINATE-DEHYDRATASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AIRS-RXN AIRS-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/6....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: *...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AIRS-RXN AIRS-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/6.3.3.1 EC-6.3.3.1]
+
** InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L
 +
* common name:
 +
** α-D-mannose 1-phosphate
 +
* molecular weight:
 +
** 258.121   
 
* Synonym(s):
 
* Synonym(s):
 +
** mannose-1-phosphate
 +
** D-mannose-1-phosphate
 +
** mannose-1-P
 +
** α-D-mannopyranose 1-phosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[2.7.7.13-RXN]]
−
** 1 [[5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[PROTON]][c]
+
* [[GAMPG]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine[c] '''+''' 1 ATP[c] '''=>''' 1 ADP[c] '''+''' 1 5-amino-1-(5-phospho-β-D-ribosyl)imidazole[c] '''+''' 1 phosphate[c] '''+''' 1 H+[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[MANNPGUANYLTRANGDP-RXN]]
−
== Genes associated with this reaction  ==
+
* [[PHOSMANMUT-RXN]]
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_1369]]
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
** [[pantograph]]-[[synechocystis]]
+
−
== Pathways  ==
+
−
* [[PWY-6121]], 5-aminoimidazole ribonucleotide biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6121 PWY-6121]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-6122]], 5-aminoimidazole ribonucleotide biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6122 PWY-6122]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-6277]], superpathway of 5-aminoimidazole ribonucleotide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6277 PWY-6277]
+
−
** '''6''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[synechocystis]]
+
−
* [[manual]]:
+
−
** [[primary_network]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CAS : 27251-84-9
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23032 23032]
+
* PUBCHEM:
−
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245607 25245607]
−
** [http://www.genome.jp/dbget-bin/www_bget?R04208 R04208]
+
* HMDB : HMDB06330
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P07244 P07244]
+
** [http://www.genome.jp/dbget-bin/www_bget?C00636 C00636]
−
** [http://www.uniprot.org/uniprot/P12043 P12043]
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/P21872 P21872]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58409 58409]
−
** [http://www.uniprot.org/uniprot/P08178 P08178]
+
* BIGG : man1p
−
** [http://www.uniprot.org/uniprot/P00967 P00967]
+
{{#set: smiles=C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}}
−
** [http://www.uniprot.org/uniprot/P16340 P16340]
+
{{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L}}
−
** [http://www.uniprot.org/uniprot/P22102 P22102]
+
{{#set: common name=α-D-mannose 1-phosphate}}
−
** [http://www.uniprot.org/uniprot/Q57656 Q57656]
+
{{#set: molecular weight=258.121    }}
−
** [http://www.uniprot.org/uniprot/O66968 O66968]
+
{{#set: common name=mannose-1-phosphate|D-mannose-1-phosphate|mannose-1-P|α-D-mannopyranose 1-phosphate}}
−
** [http://www.uniprot.org/uniprot/Q9JUA2 Q9JUA2]
+
{{#set: consumed by=2.7.7.13-RXN|GAMPG}}
−
** [http://www.uniprot.org/uniprot/P43848 P43848]
+
{{#set: reversible reaction associated=MANNPGUANYLTRANGDP-RXN|PHOSMANMUT-RXN}}
−
** [http://www.uniprot.org/uniprot/Q9PME0 Q9PME0]
+
−
** [http://www.uniprot.org/uniprot/Q64737 Q64737]
+
−
** [http://www.uniprot.org/uniprot/P20772 P20772]
+
−
** [http://www.uniprot.org/uniprot/Q55422 Q55422]
+
−
** [http://www.uniprot.org/uniprot/P52424 P52424]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: ec number=EC-6.3.3.1}}
+
−
{{#set: gene associated=Tiso_gene_1369}}
+
−
{{#set: in pathway=PWY-6121|PWY-6122|PWY-6277}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=synechocystis}}
+
−
{{#set: reconstruction category=manual}}
+
−
{{#set: reconstruction source=primary_network}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+

Revision as of 18:52, 18 March 2018

Metabolite MANNOSE-1P

  • smiles:
    • C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
  • inchi key:
    • InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L
  • common name:
    • α-D-mannose 1-phosphate
  • molecular weight:
    • 258.121
  • Synonym(s):
    • mannose-1-phosphate
    • D-mannose-1-phosphate
    • mannose-1-P
    • α-D-mannopyranose 1-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 27251-84-9
  • PUBCHEM:
  • HMDB : HMDB06330
  • LIGAND-CPD:
  • CHEBI:
  • BIGG : man1p
"C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-DEHYDROQUINATE-DEHYDRATASE-RXN&oldid=27522"