Difference between revisions of "ALCDH nadp hi"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-FUMARYL-ACETOACETATE 4-FUMARYL-ACETOACETATE] == * smiles: ** C([O-])(=O)C=CC(=O)CC(=O)CC([O-]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)=O) * inchi key: ** InChIKey...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C(O)C1(OC(C(C(C1O)O)O)=O) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** D-glucono-1,5-lactone |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 178.141 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one | ||
| + | ** gluconolactone | ||
| + | ** glucono-1,5-lactone | ||
| + | ** 1,5-gluconolactone | ||
| + | ** D-gluconolactone | ||
| + | ** glucono-δ-lactone | ||
| + | ** δ-gluconolactone | ||
| + | ** D-glucono-δ-lactone | ||
| + | ** gluconic lactone | ||
| + | ** gluconic acid lactone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GLUCONOLACT-RXN]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-11334]] | ||
== External links == | == External links == | ||
| + | * CAS : 90-80-2 | ||
| + | * DRUGBANK : DB04564 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7027 7027] |
| − | * HMDB : | + | * HMDB : HMDB00150 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00198 C00198] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.6760.html 6760] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16217 16217] |
| − | + | {{#set: smiles=C(O)C1(OC(C(C(C1O)O)O)=O)}} | |
| − | {{#set: smiles=C( | + | {{#set: inchi key=InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=D-glucono-1,5-lactone}} |
| − | {{#set: common name= | + | {{#set: molecular weight=178.141 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one|gluconolactone|glucono-1,5-lactone|1,5-gluconolactone|D-gluconolactone|glucono-δ-lactone|δ-gluconolactone|D-glucono-δ-lactone|gluconic lactone|gluconic acid lactone}} |
| − | {{#set: consumed by= | + | {{#set: consumed by=GLUCONOLACT-RXN}} |
| + | {{#set: reversible reaction associated=RXN-11334}} | ||
Revision as of 19:54, 18 March 2018
Contents
Metabolite GLC-D-LACTONE
- smiles:
- C(O)C1(OC(C(C(C1O)O)O)=O)
- inchi key:
- InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N
- common name:
- D-glucono-1,5-lactone
- molecular weight:
- 178.141
- Synonym(s):
- 3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one
- gluconolactone
- glucono-1,5-lactone
- 1,5-gluconolactone
- D-gluconolactone
- glucono-δ-lactone
- δ-gluconolactone
- D-glucono-δ-lactone
- gluconic lactone
- gluconic acid lactone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 90-80-2
- DRUGBANK : DB04564
- PUBCHEM:
- HMDB : HMDB00150
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
