Difference between revisions of "TRNA-Containing-N2-Methylguanine-26"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_11635 == * left end position: ** 4192 * transcription direction: ** POSITIVE * right end position: ** 4962 * centisome position: ** 54.7401...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19490 CPD-19490] == * smiles: ** CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_11635 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19490 CPD-19490] ==
−
* left end position:
+
* smiles:
−
** 4192
+
** CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=XXJZWLKRFPCKLB-UHFFFAOYSA-L
−
* right end position:
+
* common name:
−
** 4962
+
** 3-isopropyl-7-(methylthio)-2-oxoheptanoate
−
* centisome position:
+
* molecular weight:
−
** 54.740143    
+
** 232.251    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[DAPASYN-RXN]]
+
* [[RXN-18207]]
−
** [[pantograph]]-[[athaliana]]
+
== Reaction(s) known to produce the compound ==
−
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[creinhardtii]]
+
* [[RXN-18206]]
−
* [[DETHIOBIOTIN-SYN-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY0-1507]]
+
−
* [[PWY-7380]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4192}}
+
{{#set: smiles=CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}}
−
{{#set: transcription direction=POSITIVE}}
+
{{#set: inchi key=InChIKey=XXJZWLKRFPCKLB-UHFFFAOYSA-L}}
−
{{#set: right end position=4962}}
+
{{#set: common name=3-isopropyl-7-(methylthio)-2-oxoheptanoate}}
−
{{#set: centisome position=54.740143   }}
+
{{#set: molecular weight=232.251   }}
−
{{#set: reaction associated=DAPASYN-RXN|DETHIOBIOTIN-SYN-RXN}}
+
{{#set: consumed by=RXN-18207}}
−
{{#set: pathway associated=PWY0-1507|PWY-7380}}
+
{{#set: reversible reaction associated=RXN-18206}}

Revision as of 19:55, 18 March 2018

Metabolite CPD-19490

  • smiles:
    • CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
  • inchi key:
    • InChIKey=XXJZWLKRFPCKLB-UHFFFAOYSA-L
  • common name:
    • 3-isopropyl-7-(methylthio)-2-oxoheptanoate
  • molecular weight:
    • 232.251
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TRNA-Containing-N2-Methylguanine-26&oldid=27780"